Systematic / IUPAC Name: 2-[(3R,4S)-3-[2-(Diethylamino)ethyl]-1-(4-fluorobenzoyl)piperidin-4-yl]acetic acid
ID: Reference10794
Other Names: NAT14-335130
Formula: C20H29FN2O3
[(3R,4S)-3-[2-(Diethylamino)ethyl]-1-(4-fluorobenzoyl)-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1000 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2021 7:28:13 AM |
| InChI | InChI=1S/C20H29FN2O3/c1-3-22(4-2)11-9-17-14-23(12-10-16(17)13-19(24)25)20(26)15-5-7-18(21)8-6-15/h5-8,16-17H,3-4,9-14H2,1-2H3,(H,24,25)/t16-,17-/m0/s1 |
| InChI Key | ZQOGLFDRDXDRBU-IRXDYDNUSA-N |
| Canonical SMILES | CCN(CC)CCC1CN(CCC1CC(=O)O)C(=O)C2=CC=C(C=C2)F |
| CAS | |
| Splash | |
| Other Names | NAT14-335130 |
| ChEMBL | CHEMBL3437267 |
| PubChem | 38026427 |
| ChemSpider | 22936863 |