Systematic / IUPAC Name: 2-[4-[[(1S,4S,6S)-3-Methyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]ethanol
ID: Reference10799
Other Names: NAT28-410236
Formula: C21H36N4O2
2-[4-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2-cyclohexen-1-yl}methyl)-1-piperazinyl]ethanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1255 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2021 7:36:10 AM |
| InChI | InChI=1S/C21H36N4O2/c1-15(2)20-12-18(13-21-23-22-17(4)27-21)16(3)11-19(20)14-25-7-5-24(6-8-25)9-10-26/h11,15,18-20,26H,5-10,12-14H2,1-4H3/t18-,19-,20-/m0/s1 |
| InChI Key | AORZHWVQPWCCCB-UFYCRDLUSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C)C(C)C)CN3CCN(CC3)CCO |
| CAS | |
| Splash | |
| Other Names | NAT28-410236 |