Systematic / IUPAC Name: 4-(2-Ethyl-6-methylphenyl)-5-methyl-3-morpholinone
ID: Reference1080
Other Names: Morpholin-3-one, 4-(2-ethyl-6-methylphenyl)-5-methyl-
Formula: C14H19NO2
Class: Pesticides/Herbicides
Metolachlor morpholinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 83 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 4:02:25 PM |
| InChI | InChI=1S/C14H19NO2/c1-4-12-7-5-6-10(2)14(12)15-11(3)8-17-9-13(15)16/h5-7,11H,4,8-9H2,1-3H3 |
| InChI Key | DVBDYPDVNRJKNJ-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N2C(COCC2=O)C)C |
| CAS | 120375146 |
| Splash | |
| Other Names | Morpholin-3-one, 4-(2-ethyl-6-methylphenyl)-5-methyl- |