Systematic / IUPAC Name: 1-[[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-phenoxyphenyl)urea
ID: Reference10811
Other Names:
Urea, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-(4-phenoxyphenyl)-;
NAT13-337399
Formula: C23H29N3O2
1-{[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-3-(4-phenoxyphenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 965 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/2/2021 8:23:39 AM |
| InChI | InChI=1S/C23H29N3O2/c1-2-17-16-26-13-12-18(17)14-20(26)15-24-23(27)25-19-8-10-22(11-9-19)28-21-6-4-3-5-7-21/h3-11,17-18,20H,2,12-16H2,1H3,(H2,24,25,27)/t17-,18-,20+/m0/s1 |
| InChI Key | WMZGLBPNDYEISB-CMKODMSKSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNC(=O)NC3=CC=C(C=C3)OC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-(4-phenoxyphenyl)-; NAT13-337399 |