Systematic / IUPAC Name: N-[(3S,3aR,6R,6aR)-6-Hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3,4,5-trimethoxybenzamide
ID: Reference10814
Other Names: NAT6-274551
Formula: C16H21NO7
1,4:3,6-Dianhydro-2-deoxy-2-[(3,4,5-trimethoxybenzoyl)amino]-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1870 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/2/2021 8:29:21 AM |
| InChI | InChI=1S/C16H21NO7/c1-20-11-4-8(5-12(21-2)15(11)22-3)16(19)17-9-6-23-14-10(18)7-24-13(9)14/h4-5,9-10,13-14,18H,6-7H2,1-3H3,(H,17,19)/t9-,10+,13+,14+/m0/s1 |
| InChI Key | DYAXPFDQXODCRE-GZZJDILISA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NC2COC3C2OCC3O |
| CAS | |
| Splash | |
| Other Names | NAT6-274551 |