Systematic / IUPAC Name: 5-[(2S)-1-Cyclobutylpyrrolidin-2-yl]-3-(6-methoxypyridin-3-yl)-1,2,4-oxadiazole
ID: Reference10823
Other Names:
Pyridine, 5-[5-[(2S)-1-cyclobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-2-methoxy-;
NAT18-443219
Formula: C16H20N4O2
5-{5-[(2S)-1-Cyclobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-methoxypyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 320 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/9/2021 6:22:17 AM |
| InChI | InChI=1S/C16H20N4O2/c1-21-14-8-7-11(10-17-14)15-18-16(22-19-15)13-6-3-9-20(13)12-4-2-5-12/h7-8,10,12-13H,2-6,9H2,1H3/t13-/m0/s1 |
| InChI Key | FGKOZDOLFPYEFW-ZDUSSCGKSA-N |
| Canonical SMILES | COC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3C4CCC4 |
| CAS | |
| Splash | |
| Other Names |
Pyridine, 5-[5-[(2S)-1-cyclobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl]-2-methoxy-; NAT18-443219 |