Systematic / IUPAC Name: 5-[(2S)-1-[(2-Fluorophenyl)methyl]pyrrolidin-2-yl]-3-(6-methoxypyridin-3-yl)-1,2,4-oxadiazole
ID: Reference10846
Other Names: NAT18-443183
Formula: C19H19FN4O2
5-{5-[(2S)-1-(2-Fluorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-methoxypyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 569 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/14/2021 6:46:30 AM |
| InChI | InChI=1S/C19H19FN4O2/c1-25-17-9-8-13(11-21-17)18-22-19(26-23-18)16-7-4-10-24(16)12-14-5-2-3-6-15(14)20/h2-3,5-6,8-9,11,16H,4,7,10,12H2,1H3/t16-/m0/s1 |
| InChI Key | XBLBBVSVDZGQSQ-INIZCTEOSA-N |
| Canonical SMILES | COC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4F |
| CAS | |
| Splash | |
| Other Names | NAT18-443183 |