Systematic / IUPAC Name: (3R,5S)-1-[(4-Fluorophenyl)methyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol
ID: Reference10864
Other Names:
3-Pyrrolidinol, 1-[(4-fluorophenyl)methyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-, (3R,5S)-;
NAT18-348472
Formula: C19H18FN3O2
(3R,5S)-1-(4-Fluorobenzyl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 515 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/16/2021 2:46:25 PM |
| InChI | InChI=1S/C19H18FN3O2/c20-15-8-6-13(7-9-15)11-23-12-16(24)10-17(23)19-21-18(22-25-19)14-4-2-1-3-5-14/h1-9,16-17,24H,10-12H2/t16-,17+/m1/s1 |
| InChI Key | BFBFBEIHDCOICG-SJORKVTESA-N |
| Canonical SMILES | C1C(CN(C1C2=NC(=NO2)C3=CC=CC=C3)CC4=CC=C(C=C4)F)O |
| CAS | |
| Splash | |
| Other Names |
3-Pyrrolidinol, 1-[(4-fluorophenyl)methyl]-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-, (3R,5S)-; NAT18-348472 |