Systematic / IUPAC Name: 1-[4-[(2S,4R)-4-Hydroxy-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]piperidin-1-yl]ethanone
ID: Reference10867
Other Names: NAT18-349521
Formula: C16H26N4O3
1-{4-[(2S,4R)-4-Hydroxy-2-(3-isopropyl-1,2,4-oxadiazol-5-yl)-1-pyrrolidinyl]-1-piperidinyl}ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1010 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/16/2021 2:53:13 PM |
| InChI | InChI=1S/C16H26N4O3/c1-10(2)15-17-16(23-18-15)14-8-13(22)9-20(14)12-4-6-19(7-5-12)11(3)21/h10,12-14,22H,4-9H2,1-3H3/t13-,14+/m1/s1 |
| InChI Key | XUOHFQGMFLCWMV-KGLIPLIRSA-N |
| Canonical SMILES | CC(C)C1=NOC(=N1)C2CC(CN2C3CCN(CC3)C(=O)C)O |
| CAS | |
| Splash | |
| Other Names | NAT18-349521 |