Systematic / IUPAC Name: (3R,5S)-1-Methyl-5-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference10887
Other Names:
3-Pyrrolidinol, 1-methyl-5-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-, (3R,5S)-;
NAT18-381915
Formula: C14H14F3N3O3
(3R,5S)-1-Methyl-5-{3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl}-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 410 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/23/2021 10:34:25 AM |
| InChI | InChI=1S/C14H14F3N3O3/c1-20-7-9(21)6-11(20)13-18-12(19-23-13)8-2-4-10(5-3-8)22-14(15,16)17/h2-5,9,11,21H,6-7H2,1H3/t9-,11+/m1/s1 |
| InChI Key | XAJDAKJGFZPBQP-KOLCDFICSA-N |
| Canonical SMILES | CN1CC(CC1C2=NC(=NO2)C3=CC=C(C=C3)OC(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
3-Pyrrolidinol, 1-methyl-5-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-, (3R,5S)-; NAT18-381915 |
| PubChem | 26744515 |
| ChemSpider | 21386798 |
| ChEMBL | CHEMBL3437517 |