Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Hydroxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-pyrrolidin-1-ylethanone
ID: Reference10916
Other Names:
Ethanone, 2-[(1S,4S,5S)-4-(hydroxymethyl)-2-methyl-5-(1-methylethyl)-2-cyclohexen-1-yl]-1-(1-pyrrolidinyl)-;
NAT28-410080
Formula: C17H29NO2
2-[(1S,4S,5S)-4-(Hydroxymethyl)-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-1-(1-pyrrolidinyl)ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1938 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/4/2021 12:43:30 PM |
| InChI | InChI=1S/C17H29NO2/c1-12(2)16-9-14(13(3)8-15(16)11-19)10-17(20)18-6-4-5-7-18/h8,12,14-16,19H,4-7,9-11H2,1-3H3/t14-,15-,16-/m0/s1 |
| InChI Key | KXDPCDWIKHFAHD-JYJNAYRXSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCCC2)C(C)C)CO |
| CAS | |
| Splash | |
| Other Names |
Ethanone, 2-[(1S,4S,5S)-4-(hydroxymethyl)-2-methyl-5-(1-methylethyl)-2-cyclohexen-1-yl]-1-(1-pyrrolidinyl)-; NAT28-410080 |