Systematic / IUPAC Name: 1-[1-(4-Methoxyphenyl)-2-(methylamino)ethyl]cyclohexanol
ID: Reference1092
Other Names:
Rac N-desmethyl venlafaxine;
Cyclohexanol, 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]-
Formula: C16H25NO2
Class: Therapeutics/Prescription Drugs
N-Desmethylvenlafaxine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 98 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2015 1:48:21 PM |
| InChI | InChI=1S/C16H25NO2/c1-17-12-15(16(18)10-4-3-5-11-16)13-6-8-14(19-2)9-7-13/h6-9,15,17-18H,3-5,10-12H2,1-2H3 |
| InChI Key | MKAFOJAJJMUXLW-UHFFFAOYSA-N |
| Canonical SMILES | CNCC(C1=CC=C(C=C1)OC)C2(CCCCC2)O |
| CAS | 149289305 |
| Splash | |
| Other Names |
Rac N-desmethyl venlafaxine; Cyclohexanol, 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]- |
| ChemSpider | 2741972 |
| ChEMBL | CHEMBL1119 |
| PubChem | 3501942 |