Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxyacetamide
ID: Reference10922
Other Names: Acetamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxy-
Formula: C15H21NO5
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxyacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3385 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/8/2021 7:07:53 AM |
| InChI | InChI=1S/C15H21NO5/c1-20-8-13(18)16-14-11(7-12(17)15(14)19)9-3-5-10(21-2)6-4-9/h3-6,11-12,14-15,17,19H,7-8H2,1-2H3,(H,16,18)/t11-,12-,14-,15-/m1/s1 |
| InChI Key | MIVDEEBSAQQQIR-QHSBEEBCSA-N |
| Canonical SMILES | COCC(=O)NC1C(CC(C1O)O)C2=CC=C(C=C2)OC |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxy- |