Systematic / IUPAC Name: 1-[4-[(R)-[(3R)-4-(2-Ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-3-ethylurea
ID: Reference10925
Other Names:
Urea, N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxo-3-morpholinyl]hydroxymethyl]phenyl]-N'-ethyl-;
NAT36-509609
Formula: C18H27N3O5
1-{4-[(R)-[(3R)-4-(2-Ethoxyethyl)-5-oxo-3-morpholinyl](hydroxy)methyl]phenyl}-3-ethylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4185 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/8/2021 7:19:17 AM |
| InChI | InChI=1S/C18H27N3O5/c1-3-19-18(24)20-14-7-5-13(6-8-14)17(23)15-11-26-12-16(22)21(15)9-10-25-4-2/h5-8,15,17,23H,3-4,9-12H2,1-2H3,(H2,19,20,24)/t15-,17-/m1/s1 |
| InChI Key | IDGOGRIFWFDGSF-NVXWUHKLSA-N |
| Canonical SMILES | CCNC(=O)NC1=CC=C(C=C1)C(C2COCC(=O)N2CCOCC)O |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxo-3-morpholinyl]hydroxymethyl]phenyl]-N'-ethyl-; NAT36-509609 |