Systematic / IUPAC Name: 1-[2-Amino-1-(4-methoxyphenyl)ethyl]cyclohexanol
ID: Reference1093
Other Names:
Cyclohexanol, 1-[2-amino-1-(4-methoxyphenyl)ethyl]-;
Dinorvenlafaxine
Formula: C15H23NO2
Class: Therapeutics/Prescription Drugs
N,N-Didesmethylvenlafaxine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/12/2014 11:17:12 AM |
| InChI | InChI=1S/C15H23NO2/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15/h5-8,14,17H,2-4,9-11,16H2,1H3 |
| InChI Key | SUQHIQRIIBKNOR-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(CN)C2(CCCCC2)O |
| CAS | 3415085 |
| Splash | |
| Other Names |
Cyclohexanol, 1-[2-amino-1-(4-methoxyphenyl)ethyl]-; Dinorvenlafaxine |
| PubChem | 9795857 |
| ChEMBL | CHEMBL98158 |
| ChemSpider | 7971623 |