Systematic / IUPAC Name: 2-[(3S)-1-Cyclohexylpyrrolidin-3-yl]-1-methylbenzimidazole
ID: Reference10938
Other Names: NAT31-470402
Formula: C18H25N3
2-[(3S)-1-Cyclohexyl-3-pyrrolidinyl]-1-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 946 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2021 12:01:36 PM |
| InChI | InChI=1S/C18H25N3/c1-20-17-10-6-5-9-16(17)19-18(20)14-11-12-21(13-14)15-7-3-2-4-8-15/h5-6,9-10,14-15H,2-4,7-8,11-13H2,1H3/t14-/m0/s1 |
| InChI Key | GLJWWNMBQIYGKV-AWEZNQCLSA-N |
| Canonical SMILES | CN1C2=CC=CC=C2N=C1C3CCN(C3)C4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-470402 |