Systematic / IUPAC Name: 2-[(3R,4S)-3-[2-[4-(4-Fluorophenyl)piperazin-1-yl]ethyl]-1-(furan-2-carbonyl)piperidin-4-yl]acetic acid
ID: Reference10966
Other Names: NAT14-336643
Formula: C24H30FN3O4
[(3R,4S)-3-{2-[4-(4-Fluorophenyl)-1-piperazinyl]ethyl}-1-(2-furoyl)-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1499 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/22/2021 9:32:17 AM |
| InChI | InChI=1S/C24H30FN3O4/c25-20-3-5-21(6-4-20)27-13-11-26(12-14-27)9-7-19-17-28(10-8-18(19)16-23(29)30)24(31)22-2-1-15-32-22/h1-6,15,18-19H,7-14,16-17H2,(H,29,30)/t18-,19-/m0/s1 |
| InChI Key | OXUXMFYZJGCVTO-OALUTQOASA-N |
| Canonical SMILES | C1CN(CC(C1CC(=O)O)CCN2CCN(CC2)C3=CC=C(C=C3)F)C(=O)C4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names | NAT14-336643 |