Systematic / IUPAC Name: 2-[(3R,4S)-1-(Cyclobutanecarbonyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]acetic acid
ID: Reference10967
Other Names: NAT14-336746
Formula: C23H34N4O3
[(3R,4S)-1-(Cyclobutylcarbonyl)-3-{2-[4-(2-pyridinyl)-1-piperazinyl]ethyl}-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1469 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/22/2021 11:15:18 AM |
| InChI | InChI=1S/C23H34N4O3/c28-22(29)16-19-8-11-27(23(30)18-4-3-5-18)17-20(19)7-10-25-12-14-26(15-13-25)21-6-1-2-9-24-21/h1-2,6,9,18-20H,3-5,7-8,10-17H2,(H,28,29)/t19-,20-/m0/s1 |
| InChI Key | JDCJVBZKOGRMHE-PMACEKPBSA-N |
| Canonical SMILES | C1CC(C1)C(=O)N2CCC(C(C2)CCN3CCN(CC3)C4=CC=CC=N4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT14-336746 |