Systematic / IUPAC Name: N-[(1R,9S)-11-Benzoyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]benzamide
ID: Reference10977
Other Names: NAT11-279851
Formula: C25H23N3O3
N-[(1R,9S)-11-Benzoyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1067 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/28/2021 5:17:11 PM |
| InChI | InChI=1S/C25H23N3O3/c29-23(18-7-3-1-4-8-18)26-21-11-12-22-20-13-17(15-28(22)25(21)31)14-27(16-20)24(30)19-9-5-2-6-10-19/h1-12,17,20H,13-16H2,(H,26,29)/t17-,20+/m0/s1 |
| InChI Key | NCIXIHGBOSJDID-FXAWDEMLSA-N |
| Canonical SMILES | C1C2CN(CC1C3=CC=C(C(=O)N3C2)NC(=O)C4=CC=CC=C4)C(=O)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | NAT11-279851 |