Systematic / IUPAC Name: 2-[(3S)-1-Benzylpyrrolidin-3-yl]-5-chloro-1,3-benzoxazole
ID: Reference10981
Other Names: NAT31-456660
Formula: C18H17ClN2O
2-[(3S)-1-Benzyl-3-pyrrolidinyl]-5-chloro-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 704 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/28/2021 5:52:14 PM |
| InChI | InChI=1S/C18H17ClN2O/c19-15-6-7-17-16(10-15)20-18(22-17)14-8-9-21(12-14)11-13-4-2-1-3-5-13/h1-7,10,14H,8-9,11-12H2/t14-/m0/s1 |
| InChI Key | NACRNZGTZKVXLQ-AWEZNQCLSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(O2)C=CC(=C3)Cl)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT31-456660 |