Systematic / IUPAC Name: (3R,5S)-1-(Cyclohexylmethyl)-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference10989
Other Names:
3-Pyrrolidinol, 1-(cyclohexylmethyl)-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-, (3R,5S)-;
NAT18-348915
Formula: C20H27N3O2
(3R,5S)-1-(Cyclohexylmethyl)-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 365 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/29/2021 6:58:48 AM |
| InChI | InChI=1S/C20H27N3O2/c1-14-6-5-9-16(10-14)19-21-20(25-22-19)18-11-17(24)13-23(18)12-15-7-3-2-4-8-15/h5-6,9-10,15,17-18,24H,2-4,7-8,11-13H2,1H3/t17-,18+/m1/s1 |
| InChI Key | PGNZKSRJYJKCPI-MSOLQXFVSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3CC(CN3CC4CCCCC4)O |
| CAS | |
| Splash | |
| Other Names |
3-Pyrrolidinol, 1-(cyclohexylmethyl)-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-, (3R,5S)-; NAT18-348915 |
| ChEMBL | CHEMBL3436910 |
| PubChem | 26743838 |
| ChemSpider | 21386302 |