Systematic / IUPAC Name: 3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-propan-2-yl-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide
ID: Reference10993
Other Names: NAT23-391056
Formula: C19H30N4O2S
3-[(2S,5aS,8aR)-6-Isopropyl-1-methyl-5-oxodecahydropyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(2-thienylmethyl)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1425 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/29/2021 7:05:34 AM |
| InChI | InChI=1S/C19H30N4O2S/c1-13(2)23-9-8-16-18(23)19(25)21-11-14(22(16)3)6-7-17(24)20-12-15-5-4-10-26-15/h4-5,10,13-14,16,18H,6-9,11-12H2,1-3H3,(H,20,24)(H,21,25)/t14-,16+,18-/m0/s1 |
| InChI Key | JJHKWOGNPUSWDO-LESCRADOSA-N |
| Canonical SMILES | CC(C)N1CCC2C1C(=O)NCC(N2C)CCC(=O)NCC3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | NAT23-391056 |