Systematic / IUPAC Name: N,N-Dimethyl-4-[[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]methyl]aniline
ID: Reference11003
Other Names: NAT31-457146
Formula: C21H26N4
N,N-Dimethyl-4-{[(3S)-3-(5-methyl-1H-benzimidazol-2-yl)-1-pyrrolidinyl]methyl}aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1147 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2021 9:45:07 AM |
| InChI | InChI=1S/C21H26N4/c1-15-4-9-19-20(12-15)23-21(22-19)17-10-11-25(14-17)13-16-5-7-18(8-6-16)24(2)3/h4-9,12,17H,10-11,13-14H2,1-3H3,(H,22,23)/t17-/m0/s1 |
| InChI Key | VBFNHFCZDZPFPB-KRWDZBQOSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4=CC=C(C=C4)N(C)C |
| CAS | |
| Splash | |
| Other Names | NAT31-457146 |