Systematic / IUPAC Name: 6-Methoxy-2-[(3S)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]-1H-benzimidazole
ID: Reference11020
Other Names: NAT31-457636
Formula: C18H20N4O
5-Methoxy-2-[(3S)-1-(2-pyridinylmethyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 926 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/12/2021 11:33:47 AM |
| InChI | InChI=1S/C18H20N4O/c1-23-15-5-6-16-17(10-15)21-18(20-16)13-7-9-22(11-13)12-14-4-2-3-8-19-14/h2-6,8,10,13H,7,9,11-12H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChI Key | UEWHMKCGFXPYAN-ZDUSSCGKSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT31-457636 |