Systematic / IUPAC Name: 2-[(3S)-1-Cyclohexylpyrrolidin-3-yl]-6-(trifluoromethyl)-1H-benzimidazole
ID: Reference11021
Other Names: NAT31-457557
Formula: C18H22F3N3
2-[(3S)-1-Cyclohexyl-3-pyrrolidinyl]-5-(trifluoromethyl)-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 873 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/12/2021 11:35:34 AM |
| InChI | InChI=1S/C18H22F3N3/c19-18(20,21)13-6-7-15-16(10-13)23-17(22-15)12-8-9-24(11-12)14-4-2-1-3-5-14/h6-7,10,12,14H,1-5,8-9,11H2,(H,22,23)/t12-/m0/s1 |
| InChI Key | QHKQYFIJBOOTJW-LBPRGKRZSA-N |
| Canonical SMILES | C1CCC(CC1)N2CCC(C2)C3=NC4=C(N3)C=C(C=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT31-457557 |
| ChEMBL | CHEMBL3437328 |
| ChemSpider | 29850077 |
| PubChem | 45784262 |