Systematic / IUPAC Name: N-[[(2R,3R,4S,5S)-4-Hydroxy-5-(hydroxymethyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]oxolan-2-yl]methyl]-2-methoxyacetamide
ID: Reference11027
Other Names: NAT27-401483
Formula: C20H31N3O6
2,5-Anhydro-4,6-dideoxy-6-[(methoxyacetyl)amino]-4-[4-(2-methoxyphenyl)-1-piperazinyl]-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3573 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/12/2021 7:13:01 AM |
| InChI | InChI=1S/C20H31N3O6/c1-27-13-18(25)21-11-16-19(20(26)17(12-24)29-16)23-9-7-22(8-10-23)14-5-3-4-6-15(14)28-2/h3-6,16-17,19-20,24,26H,7-13H2,1-2H3,(H,21,25)/t16-,17+,19+,20-/m1/s1 |
| InChI Key | HEYMTFWSQNTZSR-LCLWPZTBSA-N |
| Canonical SMILES | COCC(=O)NCC1C(C(C(O1)CO)O)N2CCN(CC2)C3=CC=CC=C3OC |
| CAS | |
| Splash | |
| Other Names | NAT27-401483 |