Systematic / IUPAC Name: Ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(3-pentanyloxy)-1-cyclohexene-1-carboxylate
ID: Reference1104
Other Names:
1-Cyclohexene-1-carboxylic acid, 4-(acetylamino)-5-amino-3-(1-ethylpropoxy)-, ethyl ester, (3R-(3α,4β,5α))-;
4-Acetylamino-5-amino-3-(1-ethyl-propoxy)-cyclohex-1-enecarboxylic acid;
(3R,4R,5S)-4-Acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylic acid;
(-)-Oseltamivir;
Agucort
Formula: C16H28N2O4
Class: Therapeutics/Prescription Drugs
Oseltamivir mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/3/2014 3:41:03 PM |
| InChI | InChI=1S/C16H28N2O4/c1-5-12(6-2)22-14-9-11(16(20)21-7-3)8-13(17)15(14)18-10(4)19/h9,12-15H,5-8,17H2,1-4H3,(H,18,19)/t13-,14+,15+/m0/s1 |
| InChI Key | VSZGPKBBMSAYNT-RRFJBIMHSA-N |
| Canonical SMILES | CCC(CC)OC1C=C(CC(C1NC(=O)C)N)C(=O)OCC |
| CAS | 196618130 |
| Splash | |
| Other Names |
1-Cyclohexene-1-carboxylic acid, 4-(acetylamino)-5-amino-3-(1-ethylpropoxy)-, ethyl ester, (3R-(3α,4β,5α))-; 4-Acetylamino-5-amino-3-(1-ethyl-propoxy)-cyclohex-1-enecarboxylic acid; (3R,4R,5S)-4-Acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylic acid; (-)-Oseltamivir; Agucort |
| Wikipedia | Oseltamivir |
| ChemSpider | 58540 |
| ChEBI | CHEBI:7798 |
| ChemIDPlus | 196618130 |
| DrugBank | APRD01148 |
| ChEMBL | CHEMBL1229 |
| KEGG | C08092; D08306 |
| HMDb | HMDB14343 |
| PubChem | 65028 |