Systematic / IUPAC Name: (3R,4S)-3-Ethyl-4-[2-oxo-2-(propylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]piperidine-1-carboxamide
ID: Reference11042
Other Names: NAT14-323608
Formula: C20H28F3N3O2
(3R,4S)-3-Ethyl-4-[2-oxo-2-(propylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]-1-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1485 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2021 11:57:27 AM |
| InChI | InChI=1S/C20H28F3N3O2/c1-3-9-24-18(27)11-15-8-10-26(13-14(15)4-2)19(28)25-17-7-5-6-16(12-17)20(21,22)23/h5-7,12,14-15H,3-4,8-11,13H2,1-2H3,(H,24,27)(H,25,28)/t14-,15-/m0/s1 |
| InChI Key | GIAQIOVTVHWCPA-GJZGRUSLSA-N |
| Canonical SMILES | CCCNC(=O)CC1CCN(CC1CC)C(=O)NC2=CC=CC(=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT14-323608 |