Systematic / IUPAC Name: (3R,4S)-4-[2-(Benzylamino)-2-oxoethyl]-3-ethyl-N-(3-methoxyphenyl)piperidine-1-carboxamide
ID: Reference11043
Other Names: NAT14-323700
Formula: C24H31N3O3
(3R,4S)-4-[2-(Benzylamino)-2-oxoethyl]-3-ethyl-N-(3-methoxyphenyl)-1-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1297 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2021 12:12:52 PM |
| InChI | InChI=1S/C24H31N3O3/c1-3-19-17-27(24(29)26-21-10-7-11-22(15-21)30-2)13-12-20(19)14-23(28)25-16-18-8-5-4-6-9-18/h4-11,15,19-20H,3,12-14,16-17H2,1-2H3,(H,25,28)(H,26,29)/t19-,20-/m0/s1 |
| InChI Key | HMXCARKJWFMVFR-PMACEKPBSA-N |
| Canonical SMILES | CCC1CN(CCC1CC(=O)NCC2=CC=CC=C2)C(=O)NC3=CC(=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT14-323700 |