Systematic / IUPAC Name: 4-[[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]methyl]-N,N-dimethylaniline
ID: Reference11054
Other Names: NAT31-456674
Formula: C20H22ClN3O
4-{[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)-1-pyrrolidinyl]methyl}-N,N-dimethylaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 270 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2021 12:28:24 PM |
| InChI | InChI=1S/C20H22ClN3O/c1-23(2)17-6-3-14(4-7-17)12-24-10-9-15(13-24)20-22-18-11-16(21)5-8-19(18)25-20/h3-8,11,15H,9-10,12-13H2,1-2H3/t15-/m0/s1 |
| InChI Key | UKEBYRCTXKAKCX-HNNXBMFYSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)CN2CCC(C2)C3=NC4=C(O3)C=CC(=C4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT31-456674 |