Systematic / IUPAC Name: 5-Chloro-2-[(3S)-1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,3-benzoxazole
ID: Reference11055
Other Names: NAT31-456675
Formula: C18H16ClFN2O
5-Chloro-2-[(3S)-1-(2-fluorobenzyl)-3-pyrrolidinyl]-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 700 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2021 12:29:11 PM |
| InChI | InChI=1S/C18H16ClFN2O/c19-14-5-6-17-16(9-14)21-18(23-17)13-7-8-22(11-13)10-12-3-1-2-4-15(12)20/h1-6,9,13H,7-8,10-11H2/t13-/m0/s1 |
| InChI Key | VPCYGSPTZYEMJT-ZDUSSCGKSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(O2)C=CC(=C3)Cl)CC4=CC=CC=C4F |
| CAS | |
| Splash | |
| Other Names | NAT31-456675 |