Systematic / IUPAC Name: (4R,7S,8aS)-7-[[4-(Dimethylamino)phenyl]methylamino]-4-[3-(4-hydroxypiperidin-1-yl)-3-oxopropyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one
ID: Reference11070
Other Names: NAT23-380639
Formula: C24H37N5O3
(4R,7S,8aS)-7-{[4-(Dimethylamino)benzyl]amino}-4-[3-(4-hydroxy-1-piperidinyl)-3-oxopropyl]hexahydropyrrolo[1,2-a]pyrazin-1(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 475 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/26/2021 10:49:06 AM |
| InChI | InChI=1S/C24H37N5O3/c1-27(2)19-5-3-17(4-6-19)14-25-18-13-22-24(32)26-15-20(29(22)16-18)7-8-23(31)28-11-9-21(30)10-12-28/h3-6,18,20-22,25,30H,7-16H2,1-2H3,(H,26,32)/t18-,20+,22-/m0/s1 |
| InChI Key | RIDWXCXFLYDMIR-DWLFOUALSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)CNC2CC3C(=O)NCC(N3C2)CCC(=O)N4CCC(CC4)O |
| CAS | |
| Splash | |
| Other Names | NAT23-380639 |