Systematic / IUPAC Name: (4R,7S,8aS)-4-[3-(2,3-Dihydroindol-1-yl)-3-oxopropyl]-7-[(4-methoxyphenyl)methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one
ID: Reference11072
Other Names: NAT23-379337
Formula: C26H32N4O3
(4R,7S,8aS)-4-[3-(2,3-Dihydro-1H-indol-1-yl)-3-oxopropyl]-7-[(4-methoxybenzyl)amino]hexahydropyrrolo[1,2-a]pyrazin-1(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2635 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/26/2021 10:53:42 AM |
| InChI | InChI=1S/C26H32N4O3/c1-33-22-9-6-18(7-10-22)15-27-20-14-24-26(32)28-16-21(30(24)17-20)8-11-25(31)29-13-12-19-4-2-3-5-23(19)29/h2-7,9-10,20-21,24,27H,8,11-17H2,1H3,(H,28,32)/t20-,21+,24-/m0/s1 |
| InChI Key | SLZJTAKIRGHAKY-IMSXRSKXSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNC2CC3C(=O)NCC(N3C2)CCC(=O)N4CCC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | NAT23-379337 |