Systematic / IUPAC Name: 2-[Isopropyl(phenyl)amino]-2-oxoethanesulfonic acid
ID: Reference1108
Other Names:
2-[(1-Methylethyl)phenylamino]-2-oxo-ethanesulfonic acid;
Ethanesulfonic acid, 2-[(1-methylethyl)phenylamino]-2-oxo-
Formula: C11H15NO4S
Class: Pesticides/Herbicides
Propachlor ESA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 90 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/12/2014 12:27:45 PM |
| InChI | InChI=1S/C11H15NO4S/c1-9(2)12(10-6-4-3-5-7-10)11(13)8-17(14,15)16/h3-7,9H,8H2,1-2H3,(H,14,15,16) |
| InChI Key | BFSZJLBDHMMCAH-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N(C1=CC=CC=C1)C(=O)CS(=O)(=O)O |
| CAS | 123732854 |
| Splash | |
| Other Names |
2-[(1-Methylethyl)phenylamino]-2-oxo-ethanesulfonic acid; Ethanesulfonic acid, 2-[(1-methylethyl)phenylamino]-2-oxo- |