Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(6-morpholin-4-ylpyridin-3-yl)cyclopentyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide
ID: Reference11082
Other Names: NAT38-539406
Formula: C23H27N3O6
N-{(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(4-morpholinyl)-3-pyridinyl]cyclopentyl}-2,3-dihydro-1,4-benzodioxine-6-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2447 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/3/2021 7:59:53 AM |
| InChI | InChI=1S/C23H27N3O6/c27-17-12-16(15-2-4-20(24-13-15)26-5-7-30-8-6-26)21(22(17)28)25-23(29)14-1-3-18-19(11-14)32-10-9-31-18/h1-4,11,13,16-17,21-22,27-28H,5-10,12H2,(H,25,29)/t16-,17-,21-,22-/m1/s1 |
| InChI Key | INCZUIHOLOJHRU-XWOARTFESA-N |
| Canonical SMILES | C1COCCN1C2=NC=C(C=C2)C3CC(C(C3NC(=O)C4=CC5=C(C=C4)OCCO5)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-539406 |