Systematic / IUPAC Name: [Isopropyl(phenyl)amino](oxo)acetic acid
ID: Reference1109
Other Names:
Propachlor OA;
N-(1-Methylethyl)-N-(phenyl)oxalamic acid;
N-Isopropyl-N-phenyloxamic acid;
Acetic acid, [(1-methylethyl)phenylamino]oxo-
Formula: C11H13NO3
Class: Pesticides/Herbicides
Propachlor OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 37 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 12:50:39 PM |
| InChI | InChI=1S/C11H13NO3/c1-8(2)12(10(13)11(14)15)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,14,15) |
| InChI Key | HYHJOUPYTUBFIX-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N(C1=CC=CC=C1)C(=O)C(=O)O |
| CAS | 70628363 |
| Splash | |
| Other Names |
Propachlor OA; N-(1-Methylethyl)-N-(phenyl)oxalamic acid; N-Isopropyl-N-phenyloxamic acid; Acetic acid, [(1-methylethyl)phenylamino]oxo- |