Systematic / IUPAC Name: N-[4-[[(2S,4R)-4-Hydroxy-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]phenyl]acetamide
ID: Reference11091
Other Names: NAT18-348948
Formula: C22H24N4O3
N-[4-({(2S,4R)-4-Hydroxy-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-1-pyrrolidinyl}methyl)phenyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 930 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/3/2021 12:35:21 PM |
| InChI | InChI=1S/C22H24N4O3/c1-14-4-3-5-17(10-14)21-24-22(29-25-21)20-11-19(28)13-26(20)12-16-6-8-18(9-7-16)23-15(2)27/h3-10,19-20,28H,11-13H2,1-2H3,(H,23,27)/t19-,20+/m1/s1 |
| InChI Key | CFBOFYGBHRWHJR-UXHICEINSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3CC(CN3CC4=CC=C(C=C4)NC(=O)C)O |
| CAS | |
| Splash | |
| Other Names | NAT18-348948 |