Systematic / IUPAC Name: (3R,5S)-5-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]-1-[(2,3,4-trimethoxyphenyl)methyl]pyrrolidin-3-ol
ID: Reference11092
Other Names: NAT18-348945
Formula: C23H27N3O5
(3R,5S)-5-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]-1-(2,3,4-trimethoxybenzyl)-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 783 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/3/2021 12:39:47 PM |
| InChI | InChI=1S/C23H27N3O5/c1-14-6-5-7-15(10-14)22-24-23(31-25-22)18-11-17(27)13-26(18)12-16-8-9-19(28-2)21(30-4)20(16)29-3/h5-10,17-18,27H,11-13H2,1-4H3/t17-,18+/m1/s1 |
| InChI Key | VJGAOWZEIXXOKI-MSOLQXFVSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3CC(CN3CC4=C(C(=C(C=C4)OC)OC)OC)O |
| CAS | |
| Splash | |
| Other Names | NAT18-348945 |