Systematic / IUPAC Name: (3R,5S)-5-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-ol
ID: Reference11097
Other Names: NAT18-349590
Formula: C18H24N4O2
(3R,5S)-5-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-1-[4-(dimethylamino)benzyl]-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 460 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/3/2021 12:57:05 PM |
| InChI | InChI=1S/C18H24N4O2/c1-21(2)14-7-3-12(4-8-14)10-22-11-15(23)9-16(22)18-19-17(20-24-18)13-5-6-13/h3-4,7-8,13,15-16,23H,5-6,9-11H2,1-2H3/t15-,16+/m1/s1 |
| InChI Key | SNCZMSPLEGAWJU-CVEARBPZSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)CN2CC(CC2C3=NC(=NO3)C4CC4)O |
| CAS | |
| Splash | |
| Other Names | NAT18-349590 |