Systematic / IUPAC Name: (1R,2S,3R,4R)-3-[(1-Methylpyrazol-4-yl)methylamino]-4-pyridin-3-ylcyclopentane-1,2-diol
ID: Reference11103
Other Names: NAT38-539681
Formula: C15H20N4O2
(1R,2S,3R,4R)-3-{[(1-Methyl-1H-pyrazol-4-yl)methyl]amino}-4-(3-pyridinyl)-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1195 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/10/2021 12:02:56 PM |
| InChI | InChI=1S/C15H20N4O2/c1-19-9-10(7-18-19)6-17-14-12(5-13(20)15(14)21)11-3-2-4-16-8-11/h2-4,7-9,12-15,17,20-21H,5-6H2,1H3/t12-,13-,14-,15-/m1/s1 |
| InChI Key | XKKMGXYTUDUNAI-KBUPBQIOSA-N |
| Canonical SMILES | CN1C=C(C=N1)CNC2C(CC(C2O)O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT38-539681 |