Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-pyridin-3-ylcyclopentyl]-1-benzothiophene-2-carboxamide
ID: Reference11106
Other Names: NAT38-539183
Formula: C19H18N2O3S
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(3-pyridinyl)cyclopentyl]-1-benzothiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1938 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/10/2021 12:17:55 PM |
| InChI | InChI=1S/C19H18N2O3S/c22-14-9-13(12-5-3-7-20-10-12)17(18(14)23)21-19(24)16-8-11-4-1-2-6-15(11)25-16/h1-8,10,13-14,17-18,22-23H,9H2,(H,21,24)/t13-,14-,17-,18-/m1/s1 |
| InChI Key | SGBOHKMOXFTOJZ-DTTOXWODSA-N |
| Canonical SMILES | C1C(C(C(C1O)O)NC(=O)C2=CC3=CC=CC=C3S2)C4=CN=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT38-539183 |