Systematic / IUPAC Name: 3-[(2S,5aS,8aR)-1-Methyl-6-[(4-methylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(furan-2-ylmethyl)propanamide
ID: Reference11112
Other Names: NAT23-390823
Formula: C24H32N4O3
N-(2-Furylmethyl)-3-[(2S,5aS,8aR)-1-methyl-6-(4-methylbenzyl)-5-oxodecahydropyrrolo[3,2-E][1,4]diazepin-2-yl]propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1735 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/10/2021 11:36:27 AM |
| InChI | InChI=1S/C24H32N4O3/c1-17-5-7-18(8-6-17)16-28-12-11-21-23(28)24(30)26-14-19(27(21)2)9-10-22(29)25-15-20-4-3-13-31-20/h3-8,13,19,21,23H,9-12,14-16H2,1-2H3,(H,25,29)(H,26,30)/t19-,21+,23-/m0/s1 |
| InChI Key | GZXUPJSYLNUPMU-WPYKKVEZSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CN2CCC3C2C(=O)NCC(N3C)CCC(=O)NCC4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names | NAT23-390823 |