Systematic / IUPAC Name: 3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-(thiophen-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide
ID: Reference11114
Other Names: NAT23-391043
Formula: C21H28N4O2S2
3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-(2-thienylmethyl)decahydropyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(2-thienylmethyl)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1545 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/17/2021 12:15:32 PM |
| InChI | InChI=1S/C21H28N4O2S2/c1-24-15(6-7-19(26)22-13-16-4-2-10-28-16)12-23-21(27)20-18(24)8-9-25(20)14-17-5-3-11-29-17/h2-5,10-11,15,18,20H,6-9,12-14H2,1H3,(H,22,26)(H,23,27)/t15-,18+,20-/m0/s1 |
| InChI Key | AABCUMMNELBAAF-CVAIRZPRSA-N |
| Canonical SMILES | CN1C2CCN(C2C(=O)NCC1CCC(=O)NCC3=CC=CS3)CC4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names | NAT23-391043 |