Systematic / IUPAC Name: 2-[(3S)-1-(Cyclohexylmethyl)pyrrolidin-3-yl]-1H-imidazo[4,5-b]pyridine
ID: Reference11116
Other Names: NAT31-456612
Formula: C17H24N4
2-[(3S)-1-(Cyclohexylmethyl)-3-pyrrolidinyl]-1H-imidazo[4,5-b]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 915 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/17/2021 12:18:16 PM |
| InChI | InChI=1S/C17H24N4/c1-2-5-13(6-3-1)11-21-10-8-14(12-21)16-19-15-7-4-9-18-17(15)20-16/h4,7,9,13-14H,1-3,5-6,8,10-12H2,(H,18,19,20)/t14-/m0/s1 |
| InChI Key | YWZDCCAMBWWCFD-AWEZNQCLSA-N |
| Canonical SMILES | C1CCC(CC1)CN2CCC(C2)C3=NC4=C(N3)C=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT31-456612 |