Systematic / IUPAC Name: (1R,2S,3R,4R)-3-[(4-Chlorophenyl)methylamino]-4-(6-morpholin-4-ylpyridin-3-yl)cyclopentane-1,2-diol
ID: Reference11118
Other Names: NAT38-539768
Formula: C21H26ClN3O3
(1R,2S,3R,4R)-3-[(4-Chlorobenzyl)amino]-4-[6-(4-morpholinyl)-3-pyridinyl]-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3191 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2022 9:56:07 AM |
| InChI | InChI=1S/C21H26ClN3O3/c22-16-4-1-14(2-5-16)12-24-20-17(11-18(26)21(20)27)15-3-6-19(23-13-15)25-7-9-28-10-8-25/h1-6,13,17-18,20-21,24,26-27H,7-12H2/t17-,18-,20-,21-/m1/s1 |
| InChI Key | QDPQYNISWKHXQJ-VURPSTOHSA-N |
| Canonical SMILES | C1COCCN1C2=NC=C(C=C2)C3CC(C(C3NCC4=CC=C(C=C4)Cl)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-539768 |