Systematic / IUPAC Name: (1R,2S,3R,4R)-3-(2-Methylpropylamino)-4-(6-morpholin-4-ylpyridin-3-yl)cyclopentane-1,2-diol
ID: Reference11122
Other Names: NAT38-539774
Formula: C18H29N3O3
(1R,2S,3R,4R)-3-(Isobutylamino)-4-[6-(4-morpholinyl)-3-pyridinyl]-1,2-cyclopentanediol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1471 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2022 12:43:37 PM |
| InChI | InChI=1S/C18H29N3O3/c1-12(2)10-20-17-14(9-15(22)18(17)23)13-3-4-16(19-11-13)21-5-7-24-8-6-21/h3-4,11-12,14-15,17-18,20,22-23H,5-10H2,1-2H3/t14-,15-,17-,18-/m1/s1 |
| InChI Key | IHZQSUCXANKLBD-JOCBIADPSA-N |
| Canonical SMILES | CC(C)CNC1C(CC(C1O)O)C2=CN=C(C=C2)N3CCOCC3 |
| CAS | |
| Splash | |
| Other Names | NAT38-539774 |