Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-pyridin-3-ylcyclopentyl]-2-ethyl-5-methylpyrazole-3-carboxamide
ID: Reference11123
Other Names: NAT38-539165
Formula: C17H22N4O3
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(3-pyridinyl)cyclopentyl]-1-ethyl-3-methyl-1H-pyrazole-5-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1269 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2022 12:49:11 PM |
| InChI | InChI=1S/C17H22N4O3/c1-3-21-13(7-10(2)20-21)17(24)19-15-12(8-14(22)16(15)23)11-5-4-6-18-9-11/h4-7,9,12,14-16,22-23H,3,8H2,1-2H3,(H,19,24)/t12-,14-,15-,16-/m1/s1 |
| InChI Key | CDHFZBHTUBVCLC-DTZQCDIJSA-N |
| Canonical SMILES | CCN1C(=CC(=N1)C)C(=O)NC2C(CC(C2O)O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT38-539165 |