Systematic / IUPAC Name: 6-Methoxy-2-[(3S)-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole
ID: Reference11147
Other Names: NAT31-457646
Formula: C22H27N3O4
5-Methoxy-2-[(3S)-1-(3,4,5-trimethoxybenzyl)-3-pyrrolidinyl]-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 465 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/20/2022 2:48:23 PM |
| InChI | InChI=1S/C22H27N3O4/c1-26-16-5-6-17-18(11-16)24-22(23-17)15-7-8-25(13-15)12-14-9-19(27-2)21(29-4)20(10-14)28-3/h5-6,9-11,15H,7-8,12-13H2,1-4H3,(H,23,24)/t15-/m0/s1 |
| InChI Key | VXSJUCIDUJPXJW-HNNXBMFYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)CC4=CC(=C(C(=C4)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names | NAT31-457646 |