Systematic / IUPAC Name: 5-Methyl-2-[(3S)-1-(2-methylpropyl)pyrrolidin-3-yl]-1,3-benzoxazole
ID: Reference11150
Other Names: NAT31-456742
Formula: C16H22N2O
2-[(3S)-1-Isobutyl-3-pyrrolidinyl]-5-methyl-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 985 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/20/2022 2:50:50 PM |
| InChI | InChI=1S/C16H22N2O/c1-11(2)9-18-7-6-13(10-18)16-17-14-8-12(3)4-5-15(14)19-16/h4-5,8,11,13H,6-7,9-10H2,1-3H3/t13-/m0/s1 |
| InChI Key | MWHROXCUEMHIAV-ZDUSSCGKSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=N2)C3CCN(C3)CC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT31-456742 |