Systematic / IUPAC Name:
ID: Reference11159
Other Names: KA013
Formula: C16H10N4O3
4-[2-(4-Nitroanilino)-1,3-oxazol-5-yl]benzonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1013 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2022 1:34:53 PM |
| InChI | InChI=1S/C16H10N4O3/c17-9-11-1-3-12(4-2-11)15-10-18-16(23-15)19-13-5-7-14(8-6-13)20(21)22/h1-8,10H,(H,18,19) |
| InChI Key | DRPSOGMNERBWCV-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | KA013 |